C29H27ClF3NO3 — CID 45117725
2-[N-[2-(3-chloro-4-cyclohexylphenyl)propanoyl]-3-(trifluoromethyl)anilino]benzoic acid (PubChem CID 45117725) has the molecular formula C29H27ClF3NO3 and a molecular weight of 529.99 g/mol. Its IUPAC name is 2-[N-[2-(3-chloro-4-cyclohexylphenyl)propanoyl]-3-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 2-[N-[2-(3-chloro-4-cyclohexylphenyl)propanoyl]-3-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 45117725 |
| Molecular Formula | C29H27ClF3NO3 |
| Molecular Weight | 529.99 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 2-[N-[2-(3-chloro-4-cyclohexylphenyl)propanoyl]-3-(trifluoromethyl)anilino]benzoic acid |
| SMILES | CC(C(=O)N(c1cccc(C(F)(F)F)c1)c1ccccc1C(=O)O)c1ccc(C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C29H27ClF3NO3/c1-18(20-14-15-23(25(30)16-20)19-8-3-2-4-9-19)27(35)34(26-13-6-5-12-24(26)28(36)37)22-11-7-10-21(17-22)29(31,32)33/h5-7,10-19H,2-4,8-9H2,1H3,(H,36,37) |
| InChIKey | ZSIVJHJVOLKELE-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.99 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |