C24H27ClO3 — CID 70615917
[2-(3-chloro-4-cyclohexylphenyl)-4-oxopentyl] benzoate (PubChem CID 70615917) has the molecular formula C24H27ClO3 and a molecular weight of 398.93 g/mol. Its IUPAC name is [2-(3-chloro-4-cyclohexylphenyl)-4-oxopentyl] benzoate.
| Compound Name | [2-(3-chloro-4-cyclohexylphenyl)-4-oxopentyl] benzoate |
|---|---|
| PubChem CID | 70615917 |
| Molecular Formula | C24H27ClO3 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-(3-chloro-4-cyclohexylphenyl)-4-oxopentyl] benzoate |
| SMILES | CC(=O)CC(COC(=O)c1ccccc1)c1ccc(C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H27ClO3/c1-17(26)14-21(16-28-24(27)19-10-6-3-7-11-19)20-12-13-22(23(25)15-20)18-8-4-2-5-9-18/h3,6-7,10-13,15,18,21H,2,4-5,8-9,14,16H2,1H3 |
| InChIKey | IUHIQRUWAJSPHD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |