C13H11N3O4S2 — CID 45119934
methyl 2-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methylfuro[2,3-b]pyrrole-5-carboxylate (PubChem CID 45119934) has the molecular formula C13H11N3O4S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 2-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methylfuro[2,3-b]pyrrole-5-carboxylate.
| Compound Name | methyl 2-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methylfuro[2,3-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 45119934 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | methyl 2-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methylfuro[2,3-b]pyrrole-5-carboxylate |
| SMILES | COC(=O)c1cc2cc(/C=C3\SC(=S)N(N)C3=O)oc2n1C |
| InChI | InChI=1S/C13H11N3O4S2/c1-15-8(12(18)19-2)4-6-3-7(20-11(6)15)5-9-10(17)16(14)13(21)22-9/h3-5H,14H2,1-2H3/b9-5- |
| InChIKey | GFFSHNGWPWMJKL-UITAMQMPSA-N |
| XLogP | 1.63 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|