C7H7NO4S — CID 588940
methyl 3-methyl-6-oxo-2-sulfanylidene-1,3-oxazine-4-carboxylate (PubChem CID 588940) has the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. Its IUPAC name is methyl 3-methyl-6-oxo-2-sulfanylidene-1,3-oxazine-4-carboxylate.
| Compound Name | methyl 3-methyl-6-oxo-2-sulfanylidene-1,3-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 588940 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | methyl 3-methyl-6-oxo-2-sulfanylidene-1,3-oxazine-4-carboxylate |
| SMILES | COC(=O)c1cc(=O)oc(=S)n1C |
| InChI | InChI=1S/C7H7NO4S/c1-8-4(6(10)11-2)3-5(9)12-7(8)13/h3H,1-2H3 |
| InChIKey | YEJDVJLEDQRCIX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|