C17H14N2O5 — CID 45119962
4-[(4Z)-4-[[5-(dimethylamino)furan-2-yl]methylidene]-5-oxo-1,2-oxazol-3-yl]benzoic acid (PubChem CID 45119962) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 4-[(4Z)-4-[[5-(dimethylamino)furan-2-yl]methylidene]-5-oxo-1,2-oxazol-3-yl]benzoic acid.
| Compound Name | 4-[(4Z)-4-[[5-(dimethylamino)furan-2-yl]methylidene]-5-oxo-1,2-oxazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 45119962 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[(4Z)-4-[[5-(dimethylamino)furan-2-yl]methylidene]-5-oxo-1,2-oxazol-3-yl]benzoic acid |
| SMILES | CN(C)c1ccc(/C=C2\C(=O)ON=C2c2ccc(C(=O)O)cc2)o1 |
| InChI | InChI=1S/C17H14N2O5/c1-19(2)14-8-7-12(23-14)9-13-15(18-24-17(13)22)10-3-5-11(6-4-10)16(20)21/h3-9H,1-2H3,(H,20,21)/b13-9- |
| InChIKey | XZLUDMRCOVZOTN-LCYFTJDESA-N |
| XLogP | 2.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|