C6H10N4O2 — CID 45120829
3-(2,5-dioxoimidazolidin-4-yl)propanimidamide (PubChem CID 45120829) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)propanimidamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)propanimidamide |
|---|---|
| PubChem CID | 45120829 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)propanimidamide |
| SMILES | [H]/N=C(\N)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C6H10N4O2/c7-4(8)2-1-3-5(11)10-6(12)9-3/h3H,1-2H2,(H3,7,8)(H2,9,10,11,12) |
| InChIKey | AEPNCVGSCOXEHM-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|