C8H14N4O4 — CID 19708140
ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate (PubChem CID 19708140) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate.
| Compound Name | ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 19708140 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate |
| SMILES | CCOC(=O)N(N)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C8H14N4O4/c1-2-16-8(15)12(9)4-3-5-6(13)11-7(14)10-5/h5H,2-4,9H2,1H3,(H2,10,11,13,14) |
| InChIKey | HAQZTYIYTWDGLF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|