About ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate
ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate (PubChem CID 19708140) has the molecular formula C8H14N4O4
and a molecular weight of 230.22 g/mol. Its IUPAC name is ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate |
| PubChem CID | 19708140 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate |
| SMILES | CCOC(=O)N(N)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C8H14N4O4/c1-2-16-8(15)12(9)4-3-5-6(13)11-7(14)10-5/h5H,2-4,9H2,1H3,(H2,10,11,13,14) |
| InChIKey | HAQZTYIYTWDGLF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate?
The IUPAC name of ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate (CID 19708140) is ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate.
What is the SMILES notation for ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate?
The canonical SMILES for ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate is CCOC(=O)N(N)CCC1NC(=O)NC1=O.
What is the InChIKey of ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate?
The InChIKey is HAQZTYIYTWDGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O4/c1-2-16-8(15)12(9)4-3-5-6(13)11-7(14)10-5/h5H,2-4,9H2,1H3,(H2,10,11,13,14).
What are the key properties of ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate?
ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate has a molecular weight of 230.22 g/mol, XLogP of -1.08, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-amino-N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]carbamate is sourced from PubChem (CID 19708140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).