C5H8N4O2 — CID 45122712
2-oxo-3,4-dihydro-1H-pyrimidine-5-carbohydrazide (PubChem CID 45122712) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 2-oxo-3,4-dihydro-1H-pyrimidine-5-carbohydrazide.
| Compound Name | 2-oxo-3,4-dihydro-1H-pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 45122712 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-oxo-3,4-dihydro-1H-pyrimidine-5-carbohydrazide |
| SMILES | NNC(=O)C1=CNC(=O)NC1 |
| InChI | InChI=1S/C5H8N4O2/c6-9-4(10)3-1-7-5(11)8-2-3/h1H,2,6H2,(H,9,10)(H2,7,8,11) |
| InChIKey | AJYHCMLJCXNROF-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|