C28H50I2N2O — CID 45127733
N-(1-benzofuran-2-ylmethyl)-N',N'-diethyl-N-methyldecane-1,10-diamine;iodoethane (PubChem CID 45127733) has the molecular formula C28H50I2N2O and a molecular weight of 684.53 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-N',N'-diethyl-N-methyldecane-1,10-diamine;iodoethane.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-N',N'-diethyl-N-methyldecane-1,10-diamine;iodoethane |
|---|---|
| PubChem CID | 45127733 |
| Molecular Formula | C28H50I2N2O |
| Molecular Weight | 684.53 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-N',N'-diethyl-N-methyldecane-1,10-diamine;iodoethane |
| SMILES | CCI.CCI.CCN(CC)CCCCCCCCCCN(C)Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C24H40N2O.2C2H5I/c1-4-26(5-2)19-15-11-9-7-6-8-10-14-18-25(3)21-23-20-22-16-12-13-17-24(22)27-23;2*1-2-3/h12-13,16-17,20H,4-11,14-15,18-19,21H2,1-3H3;2*2H2,1H3 |
| InChIKey | IBQVKQBIKNCBFU-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.53 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|