C25H25F3N2O4 — CID 45133764
2-hydroxy-2-oxoacetate;1-(naphthalen-1-ylmethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-4-ium (PubChem CID 45133764) has the molecular formula C25H25F3N2O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;1-(naphthalen-1-ylmethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-4-ium.
| Compound Name | 2-hydroxy-2-oxoacetate;1-(naphthalen-1-ylmethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 45133764 |
| Molecular Formula | C25H25F3N2O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;1-(naphthalen-1-ylmethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-4-ium |
| SMILES | FC(F)(F)c1ccccc1C[NH+]1CCN(Cc2cccc3ccccc23)CC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C23H23F3N2.C2H2O4/c24-23(25,26)22-11-4-2-7-20(22)17-28-14-12-27(13-15-28)16-19-9-5-8-18-6-1-3-10-21(18)19;3-1(4)2(5)6/h1-11H,12-17H2;(H,3,4)(H,5,6) |
| InChIKey | CHYXVKJKVJLWOY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|