C18H25N3O6 — CID 45136765
methyl 3-(azepan-1-yl)-4-(2-methoxy-4-nitroanilino)-4-oxobutanoate (PubChem CID 45136765) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is methyl 3-(azepan-1-yl)-4-(2-methoxy-4-nitroanilino)-4-oxobutanoate.
| Compound Name | methyl 3-(azepan-1-yl)-4-(2-methoxy-4-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 45136765 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | methyl 3-(azepan-1-yl)-4-(2-methoxy-4-nitroanilino)-4-oxobutanoate |
| SMILES | COC(=O)CC(C(=O)Nc1ccc([N+](=O)[O-])cc1OC)N1CCCCCC1 |
| InChI | InChI=1S/C18H25N3O6/c1-26-16-11-13(21(24)25)7-8-14(16)19-18(23)15(12-17(22)27-2)20-9-5-3-4-6-10-20/h7-8,11,15H,3-6,9-10,12H2,1-2H3,(H,19,23) |
| InChIKey | YUGFLYLHHYYOCR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|