C17H21N5O4S — CID 7877217
(2S)-N-(2-methoxy-4-nitrophenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide (PubChem CID 7877217) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is (2S)-N-(2-methoxy-4-nitrophenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-methoxy-4-nitrophenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 7877217 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (2S)-N-(2-methoxy-4-nitrophenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)Sc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H21N5O4S/c1-11(27-17-20-19-15-6-4-3-5-9-21(15)17)16(23)18-13-8-7-12(22(24)25)10-14(13)26-2/h7-8,10-11H,3-6,9H2,1-2H3,(H,18,23)/t11-/m0/s1 |
| InChIKey | OEUDIRJNIIOWMK-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|