C19H21BrFNO4 — CID 45142808
3-(5-bromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide (PubChem CID 45142808) has the molecular formula C19H21BrFNO4 and a molecular weight of 426.28 g/mol. Its IUPAC name is 3-(5-bromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide.
| Compound Name | 3-(5-bromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 45142808 |
| Molecular Formula | C19H21BrFNO4 |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-(5-bromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide |
| SMILES | O=C(CC(c1ccc(F)cc1)c1cc(Br)ccc1O)NCCOCCO |
| InChI | InChI=1S/C19H21BrFNO4/c20-14-3-6-18(24)17(11-14)16(13-1-4-15(21)5-2-13)12-19(25)22-7-9-26-10-8-23/h1-6,11,16,23-24H,7-10,12H2,(H,22,25) |
| InChIKey | VDRXUKBWFLXLEI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|