C28H36N2O6S — CID 45148593
N,N-diethyl-4-[(Z)-hydroxy-[1-(3-methoxypropyl)-4,5-dioxo-2-(4-propan-2-ylphenyl)pyrrolidin-3-ylidene]methyl]benzenesulfonamide (PubChem CID 45148593) has the molecular formula C28H36N2O6S and a molecular weight of 528.67 g/mol. Its IUPAC name is N,N-diethyl-4-[(Z)-hydroxy-[1-(3-methoxypropyl)-4,5-dioxo-2-(4-propan-2-ylphenyl)pyrrolidin-3-ylidene]methyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(Z)-hydroxy-[1-(3-methoxypropyl)-4,5-dioxo-2-(4-propan-2-ylphenyl)pyrrolidin-3-ylidene]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 45148593 |
| Molecular Formula | C28H36N2O6S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N,N-diethyl-4-[(Z)-hydroxy-[1-(3-methoxypropyl)-4,5-dioxo-2-(4-propan-2-ylphenyl)pyrrolidin-3-ylidene]methyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C(O)=C2/C(=O)C(=O)N(CCCOC)C2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H36N2O6S/c1-6-29(7-2)37(34,35)23-15-13-22(14-16-23)26(31)24-25(21-11-9-20(10-12-21)19(3)4)30(17-8-18-36-5)28(33)27(24)32/h9-16,19,25,31H,6-8,17-18H2,1-5H3/b26-24- |
| InChIKey | JPDDZSAGYFWVLH-LCUIJRPUSA-N |
| XLogP | 4.30 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|