C25H30N2O7S — CID 41029982
N,N-diethyl-4-[hydroxy-[(2S)-2-(4-hydroxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide (PubChem CID 41029982) has the molecular formula C25H30N2O7S and a molecular weight of 502.59 g/mol. Its IUPAC name is N,N-diethyl-4-[hydroxy-[(2S)-2-(4-hydroxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[hydroxy-[(2S)-2-(4-hydroxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41029982 |
| Molecular Formula | C25H30N2O7S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N,N-diethyl-4-[hydroxy-[(2S)-2-(4-hydroxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(O)=C2C(=O)C(=O)N(CCCOC)[C@H]2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O7S/c1-4-26(5-2)35(32,33)20-13-9-18(10-14-20)23(29)21-22(17-7-11-19(28)12-8-17)27(15-6-16-34-3)25(31)24(21)30/h7-14,22,28-29H,4-6,15-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | GHXVADICSBHRLC-QFIPXVFZSA-N |
| XLogP | 2.88 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|