C25H29N3O8S — CID 75098414
N,N-diethyl-4-[hydroxy-[1-(3-methoxypropyl)-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide (PubChem CID 75098414) has the molecular formula C25H29N3O8S and a molecular weight of 531.59 g/mol. Its IUPAC name is N,N-diethyl-4-[hydroxy-[1-(3-methoxypropyl)-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[hydroxy-[1-(3-methoxypropyl)-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75098414 |
| Molecular Formula | C25H29N3O8S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | N,N-diethyl-4-[hydroxy-[1-(3-methoxypropyl)-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(O)=C2C(=O)C(=O)N(CCCOC)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H29N3O8S/c1-4-26(5-2)37(34,35)20-12-10-17(11-13-20)23(29)21-22(18-8-6-9-19(16-18)28(32)33)27(14-7-15-36-3)25(31)24(21)30/h6,8-13,16,22,29H,4-5,7,14-15H2,1-3H3 |
| InChIKey | VMCFQQITIDTZBZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|