C24H28N2O7S — CID 98367643
N,N-diethyl-4-[(E)-hydroxy-[(2S)-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide (PubChem CID 98367643) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-hydroxy-[(2S)-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(E)-hydroxy-[(2S)-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98367643 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N,N-diethyl-4-[(E)-hydroxy-[(2S)-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C(O)=C2\C(=O)C(=O)N(CCOC)[C@H]2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C24H28N2O7S/c1-4-25(5-2)34(31,32)19-11-9-16(10-12-19)22(28)20-21(17-7-6-8-18(27)15-17)26(13-14-33-3)24(30)23(20)29/h6-12,15,21,27-28H,4-5,13-14H2,1-3H3/b22-20+/t21-/m0/s1 |
| InChIKey | UYYBSOQRALOSNF-MRJHHRETSA-N |
| XLogP | 2.49 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|