C26H32N2O7S — CID 35339958
N,N-diethyl-4-[hydroxy-[(2R)-2-(3-methoxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide (PubChem CID 35339958) has the molecular formula C26H32N2O7S and a molecular weight of 516.62 g/mol. Its IUPAC name is N,N-diethyl-4-[hydroxy-[(2R)-2-(3-methoxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[hydroxy-[(2R)-2-(3-methoxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35339958 |
| Molecular Formula | C26H32N2O7S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N,N-diethyl-4-[hydroxy-[(2R)-2-(3-methoxyphenyl)-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(O)=C2C(=O)C(=O)N(CCCOC)[C@@H]2c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C26H32N2O7S/c1-5-27(6-2)36(32,33)21-13-11-18(12-14-21)24(29)22-23(19-9-7-10-20(17-19)35-4)28(15-8-16-34-3)26(31)25(22)30/h7,9-14,17,23,29H,5-6,8,15-16H2,1-4H3/t23-/m1/s1 |
| InChIKey | VBCKEDUZVKPEFS-HSZRJFAPSA-N |
| XLogP | 3.18 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|