C19H22N2OS — CID 45148699
N-[1H-indol-3-yl(thiophen-2-yl)methyl]-N-methylpentanamide (PubChem CID 45148699) has the molecular formula C19H22N2OS and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[1H-indol-3-yl(thiophen-2-yl)methyl]-N-methylpentanamide.
| Compound Name | N-[1H-indol-3-yl(thiophen-2-yl)methyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 45148699 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[1H-indol-3-yl(thiophen-2-yl)methyl]-N-methylpentanamide |
| SMILES | CCCCC(=O)N(C)C(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H22N2OS/c1-3-4-11-18(22)21(2)19(17-10-7-12-23-17)15-13-20-16-9-6-5-8-14(15)16/h5-10,12-13,19-20H,3-4,11H2,1-2H3 |
| InChIKey | SAKMLKYCBRFUIT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |