C24H26FN3O4 — CID 45169942
5-N-butyl-3-N-[1-(4-fluorophenyl)ethyl]-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide (PubChem CID 45169942) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is 5-N-butyl-3-N-[1-(4-fluorophenyl)ethyl]-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 5-N-butyl-3-N-[1-(4-fluorophenyl)ethyl]-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 45169942 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 5-N-butyl-3-N-[1-(4-fluorophenyl)ethyl]-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1cn(Cc2ccco2)cc(C(=O)NC(C)c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C24H26FN3O4/c1-3-4-11-26-23(30)20-14-28(13-19-6-5-12-32-19)15-21(22(20)29)24(31)27-16(2)17-7-9-18(25)10-8-17/h5-10,12,14-16H,3-4,11,13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | VJWOCSPWNLYIDO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|