C24H29N3O4 — CID 26352660
3-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-N-butyl-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide (PubChem CID 26352660) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-N-butyl-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-N-butyl-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 26352660 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-N-butyl-1-(furan-2-ylmethyl)-4-oxopyridine-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1cn(Cc2ccco2)cc(C(=O)NC[C@H]2C[C@@H]3C=C[C@H]2C3)c1=O |
| InChI | InChI=1S/C24H29N3O4/c1-2-3-8-25-23(29)20-14-27(13-19-5-4-9-31-19)15-21(22(20)28)24(30)26-12-18-11-16-6-7-17(18)10-16/h4-7,9,14-18H,2-3,8,10-13H2,1H3,(H,25,29)(H,26,30)/t16-,17+,18-/m1/s1 |
| InChIKey | ZDNVIBXFYQBCAI-FGTMMUONSA-N |
| XLogP | 2.96 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|