C16H20N2O4S — CID 4517075
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 4517075) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4517075 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)C=Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-4-17-16(21)18-15(20)11(2)22-14(19)10-7-12-5-8-13(23-3)9-6-12/h5-11H,4H2,1-3H3,(H2,17,18,20,21) |
| InChIKey | XXAHYNUARTZSCD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|