C21H30N2O6 — CID 6071334
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate (PubChem CID 6071334) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6071334 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)OC(C)C(=O)NC(=O)NCC)cc1OCC |
| InChI | InChI=1S/C21H30N2O6/c1-5-8-13-28-17-11-9-16(14-18(17)27-7-3)10-12-19(24)29-15(4)20(25)23-21(26)22-6-2/h9-12,14-15H,5-8,13H2,1-4H3,(H2,22,23,25,26)/b12-10+ |
| InChIKey | HSAHJBAMRJOWAB-ZRDIBKRKSA-N |
| XLogP | 3.05 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|