C20H19F3N4OS — CID 45183616
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-3-yl]methanone (PubChem CID 45183616) has the molecular formula C20H19F3N4OS and a molecular weight of 420.46 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-3-yl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-3-yl]methanone |
|---|---|
| PubChem CID | 45183616 |
| Molecular Formula | C20H19F3N4OS |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-3-yl]methanone |
| SMILES | O=C(c1csc2nc(-c3cccc(C(F)(F)F)c3)cn12)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C20H19F3N4OS/c21-20(22,23)14-4-1-3-13(9-14)16-11-27-17(12-29-19(27)24-16)18(28)26-8-7-25-6-2-5-15(25)10-26/h1,3-4,9,11-12,15H,2,5-8,10H2 |
| InChIKey | JFKPMOMFTREORO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |