C28H29F3N4O4 — CID 45186874
1-[1,3-dioxo-2-[[3-(trifluoromethyl)phenyl]methyl]isoindol-4-yl]-N-[(3S)-2-oxoazepan-3-yl]piperidine-3-carboxamide (PubChem CID 45186874) has the molecular formula C28H29F3N4O4 and a molecular weight of 542.56 g/mol. Its IUPAC name is 1-[1,3-dioxo-2-[[3-(trifluoromethyl)phenyl]methyl]isoindol-4-yl]-N-[(3S)-2-oxoazepan-3-yl]piperidine-3-carboxamide.
| Compound Name | 1-[1,3-dioxo-2-[[3-(trifluoromethyl)phenyl]methyl]isoindol-4-yl]-N-[(3S)-2-oxoazepan-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45186874 |
| Molecular Formula | C28H29F3N4O4 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 1-[1,3-dioxo-2-[[3-(trifluoromethyl)phenyl]methyl]isoindol-4-yl]-N-[(3S)-2-oxoazepan-3-yl]piperidine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCCNC1=O)C1CCCN(c2cccc3c2C(=O)N(Cc2cccc(C(F)(F)F)c2)C3=O)C1 |
| InChI | InChI=1S/C28H29F3N4O4/c29-28(30,31)19-8-3-6-17(14-19)15-35-26(38)20-9-4-11-22(23(20)27(35)39)34-13-5-7-18(16-34)24(36)33-21-10-1-2-12-32-25(21)37/h3-4,6,8-9,11,14,18,21H,1-2,5,7,10,12-13,15-16H2,(H,32,37)(H,33,36)/t18?,21-/m0/s1 |
| InChIKey | YHSOQOUYNWDKKB-ZYZRXSCRSA-N |
| XLogP | 3.50 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|