C16H26N2O3 — CID 45189435
1-cycloheptyl-5-(1,2-oxazolidine-2-carbonyl)piperidin-2-one (PubChem CID 45189435) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-cycloheptyl-5-(1,2-oxazolidine-2-carbonyl)piperidin-2-one.
| Compound Name | 1-cycloheptyl-5-(1,2-oxazolidine-2-carbonyl)piperidin-2-one |
|---|---|
| PubChem CID | 45189435 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-cycloheptyl-5-(1,2-oxazolidine-2-carbonyl)piperidin-2-one |
| SMILES | O=C(C1CCC(=O)N(C2CCCCCC2)C1)N1CCCO1 |
| InChI | InChI=1S/C16H26N2O3/c19-15-9-8-13(16(20)18-10-5-11-21-18)12-17(15)14-6-3-1-2-4-7-14/h13-14H,1-12H2 |
| InChIKey | GYXPSAVIYFEAKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |