C22H43N3O — CID 45189829
2-[4-(3-cyclopentylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol (PubChem CID 45189829) has the molecular formula C22H43N3O and a molecular weight of 365.61 g/mol. Its IUPAC name is 2-[4-(3-cyclopentylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-(3-cyclopentylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45189829 |
| Molecular Formula | C22H43N3O |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.34 |
| IUPAC Name | 2-[4-(3-cyclopentylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCC(N2CCN(CCCC3CCCC3)CC2CCO)CC1 |
| InChI | InChI=1S/C22H43N3O/c1-19(2)24-13-9-21(10-14-24)25-16-15-23(18-22(25)11-17-26)12-5-8-20-6-3-4-7-20/h19-22,26H,3-18H2,1-2H3 |
| InChIKey | GXHMUJGRDYYDEE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |