C19H39N3O — CID 92770438
2-[(2S)-4-pentan-3-yl-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol (PubChem CID 92770438) has the molecular formula C19H39N3O and a molecular weight of 325.54 g/mol. Its IUPAC name is 2-[(2S)-4-pentan-3-yl-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-pentan-3-yl-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 92770438 |
| Molecular Formula | C19H39N3O |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | 2-[(2S)-4-pentan-3-yl-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
| SMILES | CCC(CC)N1CCN(C2CCN(C(C)C)CC2)[C@@H](CCO)C1 |
| InChI | InChI=1S/C19H39N3O/c1-5-17(6-2)21-12-13-22(19(15-21)9-14-23)18-7-10-20(11-8-18)16(3)4/h16-19,23H,5-15H2,1-4H3/t19-/m0/s1 |
| InChIKey | GXBSRBDJAQAGBE-IBGZPJMESA-N |
| XLogP | 2.42 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |