C28H32F3N3O4S — CID 45199440
N-[2-[2-methoxy-5-[[4-(2-methylphenyl)piperazin-1-yl]methyl]phenoxy]ethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 45199440) has the molecular formula C28H32F3N3O4S and a molecular weight of 563.64 g/mol. Its IUPAC name is N-[2-[2-methoxy-5-[[4-(2-methylphenyl)piperazin-1-yl]methyl]phenoxy]ethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[2-methoxy-5-[[4-(2-methylphenyl)piperazin-1-yl]methyl]phenoxy]ethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 45199440 |
| Molecular Formula | C28H32F3N3O4S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[2-[2-methoxy-5-[[4-(2-methylphenyl)piperazin-1-yl]methyl]phenoxy]ethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(CN2CCN(c3ccccc3C)CC2)cc1OCCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32F3N3O4S/c1-21-6-3-4-9-25(21)34-15-13-33(14-16-34)20-22-10-11-26(37-2)27(18-22)38-17-12-32-39(35,36)24-8-5-7-23(19-24)28(29,30)31/h3-11,18-19,32H,12-17,20H2,1-2H3 |
| InChIKey | YCYGQICLWLRFBB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|