C20H27N3O5S — CID 45218828
1,1-dioxo-N-prop-2-enyl-N-[[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-4-yl]methyl]thiolan-3-amine (PubChem CID 45218828) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1,1-dioxo-N-prop-2-enyl-N-[[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-4-yl]methyl]thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-prop-2-enyl-N-[[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-4-yl]methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 45218828 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1,1-dioxo-N-prop-2-enyl-N-[[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-4-yl]methyl]thiolan-3-amine |
| SMILES | C=CCN(Cc1cn[nH]c1-c1cc(OC)c(OC)c(OC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H27N3O5S/c1-5-7-23(16-6-8-29(24,25)13-16)12-15-11-21-22-19(15)14-9-17(26-2)20(28-4)18(10-14)27-3/h5,9-11,16H,1,6-8,12-13H2,2-4H3,(H,21,22) |
| InChIKey | VVGXSAUNFMQEDZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|