C18H23N3O2S2 — CID 30936980
5-[[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 30936980) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 5-[[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 30936980 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 5-[[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | C=CCN(Cc1cnc(Nc2ccccc2C)s1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H23N3O2S2/c1-3-9-21(15-8-10-25(22,23)13-15)12-16-11-19-18(24-16)20-17-7-5-4-6-14(17)2/h3-7,11,15H,1,8-10,12-13H2,2H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | DVCVBAZRMPYKDB-HNNXBMFYSA-N |
| XLogP | 3.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|