C7H3F5N2O3 — CID 4523430
5-(2,2,3,3,3-pentafluoropropanoyl)-1H-pyrimidine-2,4-dione (PubChem CID 4523430) has the molecular formula C7H3F5N2O3 and a molecular weight of 258.10 g/mol. Its IUPAC name is 5-(2,2,3,3,3-pentafluoropropanoyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2,2,3,3,3-pentafluoropropanoyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4523430 |
| Molecular Formula | C7H3F5N2O3 |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 5-(2,2,3,3,3-pentafluoropropanoyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1c[nH]c(=O)[nH]c1=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F5N2O3/c8-6(9,7(10,11)12)3(15)2-1-13-5(17)14-4(2)16/h1H,(H2,13,14,16,17) |
| InChIKey | IDRDNBDHHUQVEP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|