C23H22F2N4OS2 — CID 45251108
7-[(2,3-difluorophenyl)methylamino]-3-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 45251108) has the molecular formula C23H22F2N4OS2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 7-[(2,3-difluorophenyl)methylamino]-3-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[(2,3-difluorophenyl)methylamino]-3-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 45251108 |
| Molecular Formula | C23H22F2N4OS2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 7-[(2,3-difluorophenyl)methylamino]-3-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc(C(C)n2cnc3sc4c(c3c2=O)CCC(NCc2cccc(F)c2F)C4)cs1 |
| InChI | InChI=1S/C23H22F2N4OS2/c1-12(18-10-31-13(2)28-18)29-11-27-22-20(23(29)30)16-7-6-15(8-19(16)32-22)26-9-14-4-3-5-17(24)21(14)25/h3-5,10-12,15,26H,6-9H2,1-2H3 |
| InChIKey | BKOOYECFSSWCEX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |