C23H23ClN4OS2 — CID 28954704
(7S)-7-[(3-chlorophenyl)methylamino]-3-[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 28954704) has the molecular formula C23H23ClN4OS2 and a molecular weight of 471.05 g/mol. Its IUPAC name is (7S)-7-[(3-chlorophenyl)methylamino]-3-[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-7-[(3-chlorophenyl)methylamino]-3-[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28954704 |
| Molecular Formula | C23H23ClN4OS2 |
| Molecular Weight | 471.05 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (7S)-7-[(3-chlorophenyl)methylamino]-3-[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc([C@@H](C)n2cnc3sc4c(c3c2=O)CC[C@H](NCc2cccc(Cl)c2)C4)cs1 |
| InChI | InChI=1S/C23H23ClN4OS2/c1-13(19-11-30-14(2)27-19)28-12-26-22-21(23(28)29)18-7-6-17(9-20(18)31-22)25-10-15-4-3-5-16(24)8-15/h3-5,8,11-13,17,25H,6-7,9-10H2,1-2H3/t13-,17+/m1/s1 |
| InChIKey | VUOOKPZGBNZKRE-DYVFJYSZSA-N |
| XLogP | 5.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.05 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |