C45H70O5 — CID 45258133
4-[2,4-dihydroxy-6-[(Z)-pentadec-8-enyl]phenyl]-3-[(Z)-heptadec-8-enyl]-5-hydroxy-6-methylcyclohexa-3,5-diene-1,2-dione (PubChem CID 45258133) has the molecular formula C45H70O5 and a molecular weight of 691.05 g/mol. Its IUPAC name is 4-[2,4-dihydroxy-6-[(Z)-pentadec-8-enyl]phenyl]-3-[(Z)-heptadec-8-enyl]-5-hydroxy-6-methylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-[2,4-dihydroxy-6-[(Z)-pentadec-8-enyl]phenyl]-3-[(Z)-heptadec-8-enyl]-5-hydroxy-6-methylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 45258133 |
| Molecular Formula | C45H70O5 |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.52 |
| IUPAC Name | 4-[2,4-dihydroxy-6-[(Z)-pentadec-8-enyl]phenyl]-3-[(Z)-heptadec-8-enyl]-5-hydroxy-6-methylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC/C=C\CCCCCCCc1cc(O)cc(O)c1C1=C(CCCCCCC/C=C\CCCCCCCC)C(=O)C(=O)C(C)=C1O |
| InChI | InChI=1S/C45H70O5/c1-4-6-8-10-12-14-16-18-19-21-23-25-27-29-31-33-39-42(43(48)36(3)44(49)45(39)50)41-37(34-38(46)35-40(41)47)32-30-28-26-24-22-20-17-15-13-11-9-7-5-2/h15,17-19,34-35,46-48H,4-14,16,20-33H2,1-3H3/b17-15-,19-18- |
| InChIKey | NTCHPJFWDYTKIQ-FESQGUELSA-N |
| XLogP | 13.28 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|