C13H22OS2 — CID 45258489
(E)-3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]but-2-en-1-ol (PubChem CID 45258489) has the molecular formula C13H22OS2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (E)-3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]but-2-en-1-ol.
| Compound Name | (E)-3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 45258489 |
| Molecular Formula | C13H22OS2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (E)-3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]but-2-en-1-ol |
| SMILES | CC(C)=CC1(C/C(C)=C/CO)SCCCS1 |
| InChI | InChI=1S/C13H22OS2/c1-11(2)9-13(10-12(3)5-6-14)15-7-4-8-16-13/h5,9,14H,4,6-8,10H2,1-3H3/b12-5+ |
| InChIKey | QFTLVVJIRICCNL-LFYBBSHMSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|