C17H27FOS2 — CID 101027667
(2Z,6E)-3-(1,3-dithiolan-2-yl)-2-fluoro-7,11-dimethyldodeca-2,6,10-trien-1-ol (PubChem CID 101027667) has the molecular formula C17H27FOS2 and a molecular weight of 330.53 g/mol. Its IUPAC name is (2Z,6E)-3-(1,3-dithiolan-2-yl)-2-fluoro-7,11-dimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | (2Z,6E)-3-(1,3-dithiolan-2-yl)-2-fluoro-7,11-dimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 101027667 |
| Molecular Formula | C17H27FOS2 |
| Molecular Weight | 330.53 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2Z,6E)-3-(1,3-dithiolan-2-yl)-2-fluoro-7,11-dimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C(/F)CO)C1SCCS1 |
| InChI | InChI=1S/C17H27FOS2/c1-13(2)6-4-7-14(3)8-5-9-15(16(18)12-19)17-20-10-11-21-17/h6,8,17,19H,4-5,7,9-12H2,1-3H3/b14-8+,16-15- |
| InChIKey | GDMXVOQEFAKPGN-CBKGHXGGSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|