C26H40F2O4S2 — CID 101027673
ethyl (2E,6E,10E)-3-(dimethoxymethyl)-7-(1,3-dithiolan-2-yl)-2,6-difluoro-11,15-dimethylhexadeca-2,6,10,14-tetraenoate (PubChem CID 101027673) has the molecular formula C26H40F2O4S2 and a molecular weight of 518.73 g/mol. Its IUPAC name is ethyl (2E,6E,10E)-3-(dimethoxymethyl)-7-(1,3-dithiolan-2-yl)-2,6-difluoro-11,15-dimethylhexadeca-2,6,10,14-tetraenoate.
| Compound Name | ethyl (2E,6E,10E)-3-(dimethoxymethyl)-7-(1,3-dithiolan-2-yl)-2,6-difluoro-11,15-dimethylhexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 101027673 |
| Molecular Formula | C26H40F2O4S2 |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | ethyl (2E,6E,10E)-3-(dimethoxymethyl)-7-(1,3-dithiolan-2-yl)-2,6-difluoro-11,15-dimethylhexadeca-2,6,10,14-tetraenoate |
| SMILES | CCOC(=O)/C(F)=C(/CC/C(F)=C(/CC/C=C(\C)CCC=C(C)C)C1SCCS1)C(OC)OC |
| InChI | InChI=1S/C26H40F2O4S2/c1-7-32-24(29)23(28)21(25(30-5)31-6)14-15-22(27)20(26-33-16-17-34-26)13-9-12-19(4)11-8-10-18(2)3/h10,12,25-26H,7-9,11,13-17H2,1-6H3/b19-12+,22-20+,23-21+ |
| InChIKey | IBMVYZCSSSUNEC-LQMTWADQSA-N |
| XLogP | 7.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|