C21H33NaO7S — CID 45258541
sodium [(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate (PubChem CID 45258541) has the molecular formula C21H33NaO7S and a molecular weight of 452.55 g/mol. Its IUPAC name is sodium [(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate.
| Compound Name | sodium [(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate |
|---|---|
| PubChem CID | 45258541 |
| Molecular Formula | C21H33NaO7S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | sodium [(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate |
| SMILES | C[C@]12CC[C@@H](OS(=O)(=O)[O-])C[C@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO.[Na+] |
| InChI | InChI=1S/C21H34O7S.Na/c1-19-8-5-14(28-29(25,26)27)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,24)18(23)12-22;/h13-17,22,24H,3-12H2,1-2H3,(H,25,26,27);/q;+1/p-1/t13-,14-,15-,16+,17+,19+,20+,21+;/m1./s1 |
| InChIKey | MCLISZBFEYLDCH-SKCFMAFTSA-M |
| XLogP | -0.83 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|