C25H37NO5S — CID 140884362
[(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] sulfate;pyridin-1-ium (PubChem CID 140884362) has the molecular formula C25H37NO5S and a molecular weight of 463.64 g/mol. Its IUPAC name is [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] sulfate;pyridin-1-ium.
| Compound Name | [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] sulfate;pyridin-1-ium |
|---|---|
| PubChem CID | 140884362 |
| Molecular Formula | C25H37NO5S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] sulfate;pyridin-1-ium |
| SMILES | C[C@]12CC[C@@H](OS(=O)(=O)[O-])C[C@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]21CO1.c1cc[nH+]cc1 |
| InChI | InChI=1S/C20H32O5S.C5H5N/c1-18-8-5-14(25-26(21,22)23)11-13(18)3-4-15-16(18)6-9-19(2)17(15)7-10-20(19)12-24-20;1-2-4-6-5-3-1/h13-17H,3-12H2,1-2H3,(H,21,22,23);1-5H/t13-,14-,15-,16+,17+,18+,19+,20-;/m1./s1 |
| InChIKey | VFMKVCIWKZYGRU-BOYVJUJMSA-N |
| XLogP | 4.14 |
| TPSA | 93.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|