C21H32Na2O10S2 — CID 45258659
disodium;[(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate (PubChem CID 45258659) has the molecular formula C21H32Na2O10S2 and a molecular weight of 554.59 g/mol. Its IUPAC name is disodium;[(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate.
| Compound Name | disodium;[(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate |
|---|---|
| PubChem CID | 45258659 |
| Molecular Formula | C21H32Na2O10S2 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | disodium;[(3R,5R,8R,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] sulfate |
| SMILES | C[C@]12CC[C@@H](OS(=O)(=O)[O-])C[C@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)COS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H34O10S2.2Na/c1-19-8-5-14(31-33(27,28)29)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,23)18(22)12-30-32(24,25)26;;/h13-17,23H,3-12H2,1-2H3,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2/t13-,14-,15-,16+,17+,19+,20+,21+;;/m1../s1 |
| InChIKey | VKBOJMOLZPDIAW-KQBTYVKTSA-L |
| XLogP | -4.34 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|