C32H50O4 — CID 45258560
(2Z,5R,6E,8Z,10R,12E,14E,16R,18S,19R,20S,22E)-8-ethyl-5,19-dihydroxy-10,14,16,18,20,22-hexamethyl-17-oxotetracosa-2,6,8,12,14,22-hexaenal (PubChem CID 45258560) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is (2Z,5R,6E,8Z,10R,12E,14E,16R,18S,19R,20S,22E)-8-ethyl-5,19-dihydroxy-10,14,16,18,20,22-hexamethyl-17-oxotetracosa-2,6,8,12,14,22-hexaenal.
| Compound Name | (2Z,5R,6E,8Z,10R,12E,14E,16R,18S,19R,20S,22E)-8-ethyl-5,19-dihydroxy-10,14,16,18,20,22-hexamethyl-17-oxotetracosa-2,6,8,12,14,22-hexaenal |
|---|---|
| PubChem CID | 45258560 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | (2Z,5R,6E,8Z,10R,12E,14E,16R,18S,19R,20S,22E)-8-ethyl-5,19-dihydroxy-10,14,16,18,20,22-hexamethyl-17-oxotetracosa-2,6,8,12,14,22-hexaenal |
| SMILES | C/C=C(\C)C[C@H](C)[C@@H](O)[C@H](C)C(=O)[C@H](C)/C=C(C)/C=C/C[C@@H](C)/C=C(\C=C\[C@H](O)C/C=C\C=O)CC |
| InChI | InChI=1S/C32H50O4/c1-9-23(3)20-26(6)31(35)28(8)32(36)27(7)21-24(4)14-13-15-25(5)22-29(10-2)17-18-30(34)16-11-12-19-33/h9,11-14,17-19,21-22,25-28,30-31,34-35H,10,15-16,20H2,1-8H3/b12-11-,14-13+,18-17+,23-9+,24-21+,29-22-/t25-,26+,27-,28+,30-,31-/m1/s1 |
| InChIKey | MRGWQVPJRUUDLH-HZDGETIHSA-N |
| XLogP | 7.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|