C35H62O4Si — CID 11103801
(2E,5R,6E,8Z,10R,12E,14E,16R,17R,18S,19R,20S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-17,19-dihydroxy-10,14,16,18,20-pentamethyldocosa-2,6,8,12,14-pentaenal (PubChem CID 11103801) has the molecular formula C35H62O4Si and a molecular weight of 574.96 g/mol. Its IUPAC name is (2E,5R,6E,8Z,10R,12E,14E,16R,17R,18S,19R,20S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-17,19-dihydroxy-10,14,16,18,20-pentamethyldocosa-2,6,8,12,14-pentaenal.
| Compound Name | (2E,5R,6E,8Z,10R,12E,14E,16R,17R,18S,19R,20S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-17,19-dihydroxy-10,14,16,18,20-pentamethyldocosa-2,6,8,12,14-pentaenal |
|---|---|
| PubChem CID | 11103801 |
| Molecular Formula | C35H62O4Si |
| Molecular Weight | 574.96 g/mol |
| Exact Mass | 574.44 |
| IUPAC Name | (2E,5R,6E,8Z,10R,12E,14E,16R,17R,18S,19R,20S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-17,19-dihydroxy-10,14,16,18,20-pentamethyldocosa-2,6,8,12,14-pentaenal |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O)[C@@H](C)CC)/C=C/[C@@H](C/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H62O4Si/c1-13-28(5)33(37)30(7)34(38)29(6)24-26(3)18-17-19-27(4)25-31(14-2)21-22-32(20-15-16-23-36)39-40(11,12)35(8,9)10/h15-18,21-25,27-30,32-34,37-38H,13-14,19-20H2,1-12H3/b16-15+,18-17+,22-21+,26-24+,31-25-/t27-,28+,29-,30+,32-,33-,34-/m1/s1 |
| InChIKey | RSDNOEQWXXBNGK-CVWFOUIGSA-N |
| XLogP | 8.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.96 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|