C22H14Cl2N2O — CID 45258841
5-(2,6-dichlorophenyl)-2,4-diphenylpyrazole-3-carbaldehyde (PubChem CID 45258841) has the molecular formula C22H14Cl2N2O and a molecular weight of 393.27 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-2,4-diphenylpyrazole-3-carbaldehyde.
| Compound Name | 5-(2,6-dichlorophenyl)-2,4-diphenylpyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 45258841 |
| Molecular Formula | C22H14Cl2N2O |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-2,4-diphenylpyrazole-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)c(-c2c(Cl)cccc2Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H14Cl2N2O/c23-17-12-7-13-18(24)21(17)22-20(15-8-3-1-4-9-15)19(14-27)26(25-22)16-10-5-2-6-11-16/h1-14H |
| InChIKey | PUGANCPRZHTBKV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|