C17H12ClN3O2 — CID 91927842
5-chloro-4-[(E)-2-nitroethenyl]-1,3-diphenylpyrazole (PubChem CID 91927842) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 5-chloro-4-[(E)-2-nitroethenyl]-1,3-diphenylpyrazole.
| Compound Name | 5-chloro-4-[(E)-2-nitroethenyl]-1,3-diphenylpyrazole |
|---|---|
| PubChem CID | 91927842 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-chloro-4-[(E)-2-nitroethenyl]-1,3-diphenylpyrazole |
| SMILES | O=[N+]([O-])/C=C/c1c(-c2ccccc2)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C17H12ClN3O2/c18-17-15(11-12-20(22)23)16(13-7-3-1-4-8-13)19-21(17)14-9-5-2-6-10-14/h1-12H/b12-11+ |
| InChIKey | BMAOKAPDKDAQAN-VAWYXSNFSA-N |
| XLogP | 4.44 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|