C16H27Cl2N3 — CID 45263151
4-(aminomethyl)-N,N-dicyclopentylpyridin-3-amine;dihydrochloride (PubChem CID 45263151) has the molecular formula C16H27Cl2N3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-dicyclopentylpyridin-3-amine;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N,N-dicyclopentylpyridin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 45263151 |
| Molecular Formula | C16H27Cl2N3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-(aminomethyl)-N,N-dicyclopentylpyridin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccncc1N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C16H25N3.2ClH/c17-11-13-9-10-18-12-16(13)19(14-5-1-2-6-14)15-7-3-4-8-15;;/h9-10,12,14-15H,1-8,11,17H2;2*1H |
| InChIKey | DKIRVLAKYJAOJV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |