C7H12ClNO2 — CID 45265238
cis-(1S,2R)-2-amino-4-methylidenecyclopentane-1-carboxylic acid;hydrochloride (PubChem CID 45265238) has the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. Its IUPAC name is cis-(1S,2R)-2-amino-4-methylidenecyclopentane-1-carboxylic acid;hydrochloride.
| Compound Name | cis-(1S,2R)-2-amino-4-methylidenecyclopentane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45265238 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | cis-(1S,2R)-2-amino-4-methylidenecyclopentane-1-carboxylic acid;hydrochloride |
| SMILES | C=C1C[C@@H](N)[C@@H](C(=O)O)C1.Cl |
| InChI | InChI=1S/C7H11NO2.ClH/c1-4-2-5(7(9)10)6(8)3-4;/h5-6H,1-3,8H2,(H,9,10);1H/t5-,6+;/m0./s1 |
| InChIKey | SWRJAYRNZLIDMU-RIHPBJNCSA-N |
| XLogP | 0.79 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|