C8H13NO2 — CID 56674076
2-amino-4-methylidenecyclohexane-1-carboxylic acid (PubChem CID 56674076) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-amino-4-methylidenecyclohexane-1-carboxylic acid.
| Compound Name | 2-amino-4-methylidenecyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 56674076 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-amino-4-methylidenecyclohexane-1-carboxylic acid |
| SMILES | C=C1CCC(C(=O)O)C(N)C1 |
| InChI | InChI=1S/C8H13NO2/c1-5-2-3-6(8(10)11)7(9)4-5/h6-7H,1-4,9H2,(H,10,11) |
| InChIKey | ZNECJAKZJYNBPL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|