C20H23N5OS — CID 45267362
N-(6-amino-3-pyridinyl)-4-[(3-methyl-1-benzothiophen-2-yl)methyl]piperazine-1-carboxamide (PubChem CID 45267362) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-4-[(3-methyl-1-benzothiophen-2-yl)methyl]piperazine-1-carboxamide.
| Compound Name | N-(6-amino-3-pyridinyl)-4-[(3-methyl-1-benzothiophen-2-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 45267362 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-4-[(3-methyl-1-benzothiophen-2-yl)methyl]piperazine-1-carboxamide |
| SMILES | Cc1c(CN2CCN(C(=O)Nc3ccc(N)nc3)CC2)sc2ccccc12 |
| InChI | InChI=1S/C20H23N5OS/c1-14-16-4-2-3-5-17(16)27-18(14)13-24-8-10-25(11-9-24)20(26)23-15-6-7-19(21)22-12-15/h2-7,12H,8-11,13H2,1H3,(H2,21,22)(H,23,26) |
| InChIKey | AJKCAVGCYGCLQC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |