C16H20O5 — CID 45271087
(1R,2S,5S,9R,10S,13S)-2,10-dimethyl-6-methylidene-8,14,16-trioxatetracyclo[8.6.0.01,13.05,9]hexadecane-7,11-dione (PubChem CID 45271087) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1R,2S,5S,9R,10S,13S)-2,10-dimethyl-6-methylidene-8,14,16-trioxatetracyclo[8.6.0.01,13.05,9]hexadecane-7,11-dione.
| Compound Name | (1R,2S,5S,9R,10S,13S)-2,10-dimethyl-6-methylidene-8,14,16-trioxatetracyclo[8.6.0.01,13.05,9]hexadecane-7,11-dione |
|---|---|
| PubChem CID | 45271087 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1R,2S,5S,9R,10S,13S)-2,10-dimethyl-6-methylidene-8,14,16-trioxatetracyclo[8.6.0.01,13.05,9]hexadecane-7,11-dione |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1CC[C@H](C)[C@]13OCO[C@H]1CC(=O)[C@@]23C |
| InChI | InChI=1S/C16H20O5/c1-8-4-5-10-9(2)14(18)21-13(10)15(3)11(17)6-12-16(8,15)20-7-19-12/h8,10,12-13H,2,4-7H2,1,3H3/t8-,10-,12-,13+,15-,16-/m0/s1 |
| InChIKey | MKFAKRXABWCCBH-AEZQZKAESA-N |
| XLogP | 1.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|